C36H53N3O3 — CID 3541342
cyclohexyl-[5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 3541342) has the molecular formula C36H53N3O3 and a molecular weight of 575.84 g/mol. Its IUPAC name is cyclohexyl-[5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 3541342 |
| Molecular Formula | C36H53N3O3 |
| Molecular Weight | 575.84 g/mol |
| Exact Mass | 575.41 |
| IUPAC Name | cyclohexyl-[5-(2,3,4,6,7,8-hexahydropyrimido[1,2-a]pyrimidin-1-ylmethyl)-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CC12CCC(O)CC13C=CC1(C(C(=O)C4CCCCC4)=C3)C2CCC2(C)C1CCC2(O)CN1CCCN2CCCN=C21 |
| InChI | InChI=1S/C36H53N3O3/c1-32-13-10-26(40)22-34(32)16-17-36(27(23-34)30(41)25-8-4-3-5-9-25)28(32)11-14-33(2)29(36)12-15-35(33,42)24-39-21-7-20-38-19-6-18-37-31(38)39/h16-17,23,25-26,28-29,40,42H,3-15,18-22,24H2,1-2H3 |
| InChIKey | JSKXGWDAIYMDQJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.84 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|