C17H26N3O4+ — CID 3546171
1-methyl-N-[(3,4,5-trimethoxyphenyl)methylideneamino]piperidin-1-ium-2-carboxamide (PubChem CID 3546171) has the molecular formula C17H26N3O4+ and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-methyl-N-[(3,4,5-trimethoxyphenyl)methylideneamino]piperidin-1-ium-2-carboxamide.
| Compound Name | 1-methyl-N-[(3,4,5-trimethoxyphenyl)methylideneamino]piperidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 3546171 |
| Molecular Formula | C17H26N3O4+ |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 1-methyl-N-[(3,4,5-trimethoxyphenyl)methylideneamino]piperidin-1-ium-2-carboxamide |
| SMILES | COc1cc(C=NNC(=O)C2CCCC[NH+]2C)cc(OC)c1OC |
| InChI | InChI=1S/C17H25N3O4/c1-20-8-6-5-7-13(20)17(21)19-18-11-12-9-14(22-2)16(24-4)15(10-12)23-3/h9-11,13H,5-8H2,1-4H3,(H,19,21)/p+1 |
| InChIKey | MNRSZTOLTZGOHS-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|