C14H21F3N6O2 — CID 36580755
4-(cyclohexylcarbamoylamino)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]butanamide (PubChem CID 36580755) has the molecular formula C14H21F3N6O2 and a molecular weight of 362.36 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]butanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]butanamide |
|---|---|
| PubChem CID | 36580755 |
| Molecular Formula | C14H21F3N6O2 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]butanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)Nc1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H21F3N6O2/c15-14(16,17)11-21-12(23-22-11)20-10(24)7-4-8-18-13(25)19-9-5-2-1-3-6-9/h9H,1-8H2,(H2,18,19,25)(H2,20,21,22,23,24) |
| InChIKey | OULRRIPUKMXSTH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|