C24H14N2O3S — CID 3713658
2-(5-benzoyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)indene-1,3-dione (PubChem CID 3713658) has the molecular formula C24H14N2O3S and a molecular weight of 410.45 g/mol. Its IUPAC name is 2-(5-benzoyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)indene-1,3-dione.
| Compound Name | 2-(5-benzoyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)indene-1,3-dione |
|---|---|
| PubChem CID | 3713658 |
| Molecular Formula | C24H14N2O3S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 2-(5-benzoyl-3-phenyl-1,3,4-thiadiazol-2-ylidene)indene-1,3-dione |
| SMILES | O=C(C1=NN(c2ccccc2)C(=C2C(=O)c3ccccc3C2=O)S1)c1ccccc1 |
| InChI | InChI=1S/C24H14N2O3S/c27-20(15-9-3-1-4-10-15)23-25-26(16-11-5-2-6-12-16)24(30-23)19-21(28)17-13-7-8-14-18(17)22(19)29/h1-14H |
| InChIKey | RZGUYELKFSIMKY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|