C24H17N5O2S — CID 3345934
5-(5-oxo-3-phenyl-1H-pyrazol-4-ylidene)-N,4-diphenyl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 3345934) has the molecular formula C24H17N5O2S and a molecular weight of 439.50 g/mol. Its IUPAC name is 5-(5-oxo-3-phenyl-1H-pyrazol-4-ylidene)-N,4-diphenyl-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-(5-oxo-3-phenyl-1H-pyrazol-4-ylidene)-N,4-diphenyl-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 3345934 |
| Molecular Formula | C24H17N5O2S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 5-(5-oxo-3-phenyl-1H-pyrazol-4-ylidene)-N,4-diphenyl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1=NN(c2ccccc2)C(=C2C(=O)NN=C2c2ccccc2)S1 |
| InChI | InChI=1S/C24H17N5O2S/c30-21-19(20(26-27-21)16-10-4-1-5-11-16)24-29(18-14-8-3-9-15-18)28-23(32-24)22(31)25-17-12-6-2-7-13-17/h1-15H,(H,25,31)(H,27,30) |
| InChIKey | PHPOFHSCWPNFLO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|