C24H21Cl2F3N4O2S2 — CID 4070117
1-[5-[(2,5-dichlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 4070117) has the molecular formula C24H21Cl2F3N4O2S2 and a molecular weight of 589.49 g/mol. Its IUPAC name is 1-[5-[(2,5-dichlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[5-[(2,5-dichlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 4070117 |
| Molecular Formula | C24H21Cl2F3N4O2S2 |
| Molecular Weight | 589.49 g/mol |
| Exact Mass | 588.04 |
| IUPAC Name | 1-[5-[(2,5-dichlorophenyl)sulfamoyl]-2-pyrrolidin-1-ylphenyl]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | O=S(=O)(Nc1cc(Cl)ccc1Cl)c1ccc(N2CCCC2)c(NC(=S)Nc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C24H21Cl2F3N4O2S2/c25-15-7-9-18(26)20(13-15)32-37(34,35)16-8-10-22(33-11-3-4-12-33)21(14-16)31-23(36)30-19-6-2-1-5-17(19)24(27,28)29/h1-2,5-10,13-14,32H,3-4,11-12H2,(H2,30,31,36) |
| InChIKey | CLYYNONTEUYBSX-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.49 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|