C22H16F3N3OS — CID 42347104
1,3-thiazol-4-yl-[(1R)-1-[3-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 42347104) has the molecular formula C22H16F3N3OS and a molecular weight of 427.45 g/mol. Its IUPAC name is 1,3-thiazol-4-yl-[(1R)-1-[3-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | 1,3-thiazol-4-yl-[(1R)-1-[3-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 42347104 |
| Molecular Formula | C22H16F3N3OS |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 1,3-thiazol-4-yl-[(1R)-1-[3-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | O=C(c1cscn1)N1CCc2c([nH]c3ccccc23)[C@H]1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H16F3N3OS/c23-22(24,25)14-5-3-4-13(10-14)20-19-16(15-6-1-2-7-17(15)27-19)8-9-28(20)21(29)18-11-30-12-26-18/h1-7,10-12,20,27H,8-9H2/t20-/m1/s1 |
| InChIKey | OWVBETKKGDUALV-HXUWFJFHSA-N |
| XLogP | 5.43 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|