C25H28N2O4 — CID 44571517
(4E)-4-[4-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]butoxyimino]-4-phenylbutanoic acid (PubChem CID 44571517) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is (4E)-4-[4-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]butoxyimino]-4-phenylbutanoic acid.
| Compound Name | (4E)-4-[4-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]butoxyimino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 44571517 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (4E)-4-[4-[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]butoxyimino]-4-phenylbutanoic acid |
| SMILES | Cc1ccc(-c2nc(CCCCO/N=C(\CCC(=O)O)c3ccccc3)c(C)o2)cc1 |
| InChI | InChI=1S/C25H28N2O4/c1-18-11-13-21(14-12-18)25-26-22(19(2)31-25)10-6-7-17-30-27-23(15-16-24(28)29)20-8-4-3-5-9-20/h3-5,8-9,11-14H,6-7,10,15-17H2,1-2H3,(H,28,29)/b27-23+ |
| InChIKey | JPMQKHBVHHYHGO-SLEBQGDGSA-N |
| XLogP | 5.57 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|