C18H32Br2N2O2 — CID 44662987
1-[(E)-4-(2,5-dimethyl-4-oxopiperidin-1-ium-1-yl)but-2-enyl]-2,5-dimethylpiperidin-1-ium-4-one dibromide (PubChem CID 44662987) has the molecular formula C18H32Br2N2O2 and a molecular weight of 468.27 g/mol. Its IUPAC name is 1-[(E)-4-(2,5-dimethyl-4-oxopiperidin-1-ium-1-yl)but-2-enyl]-2,5-dimethylpiperidin-1-ium-4-one dibromide.
| Compound Name | 1-[(E)-4-(2,5-dimethyl-4-oxopiperidin-1-ium-1-yl)but-2-enyl]-2,5-dimethylpiperidin-1-ium-4-one dibromide |
|---|---|
| PubChem CID | 44662987 |
| Molecular Formula | C18H32Br2N2O2 |
| Molecular Weight | 468.27 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 1-[(E)-4-(2,5-dimethyl-4-oxopiperidin-1-ium-1-yl)but-2-enyl]-2,5-dimethylpiperidin-1-ium-4-one dibromide |
| SMILES | CC1C[NH+](C/C=C/C[NH+]2CC(C)C(=O)CC2C)C(C)CC1=O.[Br-].[Br-] |
| InChI | InChI=1S/C18H30N2O2.2BrH/c1-13-11-19(15(3)9-17(13)21)7-5-6-8-20-12-14(2)18(22)10-16(20)4;;/h5-6,13-16H,7-12H2,1-4H3;2*1H/b6-5+;; |
| InChIKey | URKDKMOIHUSKSJ-TXOOBNKBSA-N |
| XLogP | -6.68 |
| TPSA | 43.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.27 |
| LogP ≤ 5 | -6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|