C10H16NO+ — CID 6581558
(2S,5R)-2,5-dimethyl-1-prop-2-ynylpiperidin-1-ium-4-one (PubChem CID 6581558) has the molecular formula C10H16NO+ and a molecular weight of 166.24 g/mol. Its IUPAC name is (2S,5R)-2,5-dimethyl-1-prop-2-ynylpiperidin-1-ium-4-one.
| Compound Name | (2S,5R)-2,5-dimethyl-1-prop-2-ynylpiperidin-1-ium-4-one |
|---|---|
| PubChem CID | 6581558 |
| Molecular Formula | C10H16NO+ |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | (2S,5R)-2,5-dimethyl-1-prop-2-ynylpiperidin-1-ium-4-one |
| SMILES | C#CC[NH+]1C[C@@H](C)C(=O)C[C@@H]1C |
| InChI | InChI=1S/C10H15NO/c1-4-5-11-7-8(2)10(12)6-9(11)3/h1,8-9H,5-7H2,2-3H3/p+1/t8-,9+/m1/s1 |
| InChIKey | QKOONSQMCOIEKG-BDAKNGLRSA-O |
| XLogP | -0.50 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|