C38H37ClN2O3 — CID 46212691
ethyl 8-[3-(7-azabicyclo[2.2.1]heptan-7-yl)-6-(7-azoniabicyclo[2.2.1]heptan-7-ylidene)xanthen-9-yl]naphthalene-1-carboxylate chloride (PubChem CID 46212691) has the molecular formula C38H37ClN2O3 and a molecular weight of 605.18 g/mol. Its IUPAC name is ethyl 8-[3-(7-azabicyclo[2.2.1]heptan-7-yl)-6-(7-azoniabicyclo[2.2.1]heptan-7-ylidene)xanthen-9-yl]naphthalene-1-carboxylate chloride.
| Compound Name | ethyl 8-[3-(7-azabicyclo[2.2.1]heptan-7-yl)-6-(7-azoniabicyclo[2.2.1]heptan-7-ylidene)xanthen-9-yl]naphthalene-1-carboxylate chloride |
|---|---|
| PubChem CID | 46212691 |
| Molecular Formula | C38H37ClN2O3 |
| Molecular Weight | 605.18 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | ethyl 8-[3-(7-azabicyclo[2.2.1]heptan-7-yl)-6-(7-azoniabicyclo[2.2.1]heptan-7-ylidene)xanthen-9-yl]naphthalene-1-carboxylate chloride |
| SMILES | CCOC(=O)c1cccc2cccc(-c3c4ccc(=[N+]5C6CCC5CC6)cc-4oc4cc(N5C6CCC5CC6)ccc34)c12.[Cl-] |
| InChI | InChI=1S/C38H37N2O3.ClH/c1-2-42-38(41)33-8-4-6-23-5-3-7-32(36(23)33)37-30-19-17-28(39-24-9-10-25(39)12-11-24)21-34(30)43-35-22-29(18-20-31(35)37)40-26-13-14-27(40)16-15-26;/h3-8,17-22,24-27H,2,9-16H2,1H3;1H/q+1;/p-1 |
| InChIKey | SQJIXIVJQSZASV-UHFFFAOYSA-M |
| XLogP | 4.77 |
| TPSA | 45.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.18 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|