About 5-nitrononadecane
5-nitrononadecane (PubChem CID 167528506) has the molecular formula C19H39NO2
and a molecular weight of 313.53 g/mol. Its IUPAC name is 5-nitrononadecane.
Molecular Properties
| Compound Name | 5-nitrononadecane |
| PubChem CID | 167528506 |
| Molecular Formula | C19H39NO2 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.30 |
| IUPAC Name | 5-nitrononadecane |
| SMILES | CCCCCCCCCCCCCCC(CCCC)[N+](=O)[O-] |
| InChI | InChI=1S/C19H39NO2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-19(20(21)22)17-6-4-2/h19H,3-18H2,1-2H3 |
| InChIKey | NBMWZHXPRJECCU-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-nitrononadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-nitrononadecane?
The IUPAC name of 5-nitrononadecane (CID 167528506) is 5-nitrononadecane.
What is the SMILES notation for 5-nitrononadecane?
The canonical SMILES for 5-nitrononadecane is CCCCCCCCCCCCCCC(CCCC)[N+](=O)[O-].
What is the InChIKey of 5-nitrononadecane?
The InChIKey is NBMWZHXPRJECCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39NO2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18-19(20(21)22)17-6-4-2/h19H,3-18H2,1-2H3.
What are the key properties of 5-nitrononadecane?
5-nitrononadecane has a molecular weight of 313.53 g/mol, XLogP of 6.91, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-nitrononadecane is sourced from PubChem (CID 167528506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).