C15H9FN2O3 — CID 51353478
(7Z)-7-(6-fluoro-3-oxo-1H-indol-2-ylidene)-3a,7a-dihydro-1,2-benzoxazol-6-one (PubChem CID 51353478) has the molecular formula C15H9FN2O3 and a molecular weight of 284.25 g/mol. Its IUPAC name is (7Z)-7-(6-fluoro-3-oxo-1H-indol-2-ylidene)-3a,7a-dihydro-1,2-benzoxazol-6-one.
| Compound Name | (7Z)-7-(6-fluoro-3-oxo-1H-indol-2-ylidene)-3a,7a-dihydro-1,2-benzoxazol-6-one |
|---|---|
| PubChem CID | 51353478 |
| Molecular Formula | C15H9FN2O3 |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (7Z)-7-(6-fluoro-3-oxo-1H-indol-2-ylidene)-3a,7a-dihydro-1,2-benzoxazol-6-one |
| SMILES | O=C1C=CC2C=NOC2/C1=C1/Nc2cc(F)ccc2C1=O |
| InChI | InChI=1S/C15H9FN2O3/c16-8-2-3-9-10(5-8)18-13(14(9)20)12-11(19)4-1-7-6-17-21-15(7)12/h1-7,15,18H/b13-12+ |
| InChIKey | CAFMJQGIUAFRNE-OUKQBFOZSA-N |
| XLogP | 1.83 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|