C15H22Cl3NO4S — CID 53341687
(R)-2-methyl-N-[(1S)-2,2,2-trichloro-1-(2,3,4-trimethoxyphenyl)ethyl]propane-2-sulfinamide (PubChem CID 53341687) has the molecular formula C15H22Cl3NO4S and a molecular weight of 418.77 g/mol. Its IUPAC name is (R)-2-methyl-N-[(1S)-2,2,2-trichloro-1-(2,3,4-trimethoxyphenyl)ethyl]propane-2-sulfinamide.
| Compound Name | (R)-2-methyl-N-[(1S)-2,2,2-trichloro-1-(2,3,4-trimethoxyphenyl)ethyl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 53341687 |
| Molecular Formula | C15H22Cl3NO4S |
| Molecular Weight | 418.77 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | (R)-2-methyl-N-[(1S)-2,2,2-trichloro-1-(2,3,4-trimethoxyphenyl)ethyl]propane-2-sulfinamide |
| SMILES | COc1ccc([C@H](N[S@](=O)C(C)(C)C)C(Cl)(Cl)Cl)c(OC)c1OC |
| InChI | InChI=1S/C15H22Cl3NO4S/c1-14(2,3)24(20)19-13(15(16,17)18)9-7-8-10(21-4)12(23-6)11(9)22-5/h7-8,13,19H,1-6H3/t13-,24+/m0/s1 |
| InChIKey | DLVPDGKXNVQNHG-RKNYENMMSA-N |
| XLogP | 4.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.77 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|