C18H22O5S — CID 537847
methyl 2-[3-(benzenesulfonyl)-4-(2-methylpropanoyl)cyclopent-2-en-1-yl]acetate (PubChem CID 537847) has the molecular formula C18H22O5S and a molecular weight of 350.44 g/mol. Its IUPAC name is methyl 2-[3-(benzenesulfonyl)-4-(2-methylpropanoyl)cyclopent-2-en-1-yl]acetate.
| Compound Name | methyl 2-[3-(benzenesulfonyl)-4-(2-methylpropanoyl)cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 537847 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | methyl 2-[3-(benzenesulfonyl)-4-(2-methylpropanoyl)cyclopent-2-en-1-yl]acetate |
| SMILES | COC(=O)CC1C=C(S(=O)(=O)c2ccccc2)C(C(=O)C(C)C)C1 |
| InChI | InChI=1S/C18H22O5S/c1-12(2)18(20)15-9-13(11-17(19)23-3)10-16(15)24(21,22)14-7-5-4-6-8-14/h4-8,10,12-13,15H,9,11H2,1-3H3 |
| InChIKey | BTSSYLNAYUXWBQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |