C22H28FNO — CID 54089459
5-[4-(4-butylphenyl)-1-methoxycyclohexyl]-2-fluoropenta-2,4-dienenitrile (PubChem CID 54089459) has the molecular formula C22H28FNO and a molecular weight of 341.47 g/mol. Its IUPAC name is 5-[4-(4-butylphenyl)-1-methoxycyclohexyl]-2-fluoropenta-2,4-dienenitrile.
| Compound Name | 5-[4-(4-butylphenyl)-1-methoxycyclohexyl]-2-fluoropenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 54089459 |
| Molecular Formula | C22H28FNO |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 5-[4-(4-butylphenyl)-1-methoxycyclohexyl]-2-fluoropenta-2,4-dienenitrile |
| SMILES | CCCCc1ccc(C2CCC(C=CC=C(F)C#N)(OC)CC2)cc1 |
| InChI | InChI=1S/C22H28FNO/c1-3-4-6-18-8-10-19(11-9-18)20-12-15-22(25-2,16-13-20)14-5-7-21(23)17-24/h5,7-11,14,20H,3-4,6,12-13,15-16H2,1-2H3 |
| InChIKey | MSVGOOQMHUKNQO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|