C28H30Cl3NO5 — CID 54231976
2,2,2-trichloroethyl 4-[3-(3-hydroxypropoxy)phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate (PubChem CID 54231976) has the molecular formula C28H30Cl3NO5 and a molecular weight of 566.91 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 4-[3-(3-hydroxypropoxy)phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 4-[3-(3-hydroxypropoxy)phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54231976 |
| Molecular Formula | C28H30Cl3NO5 |
| Molecular Weight | 566.91 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | 2,2,2-trichloroethyl 4-[3-(3-hydroxypropoxy)phenyl]-3-(naphthalen-2-ylmethoxy)piperidine-1-carboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)N1CCC(c2cccc(OCCCO)c2)C(OCc2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C28H30Cl3NO5/c29-28(30,31)19-37-27(34)32-12-11-25(23-7-3-8-24(16-23)35-14-4-13-33)26(17-32)36-18-20-9-10-21-5-1-2-6-22(21)15-20/h1-3,5-10,15-16,25-26,33H,4,11-14,17-19H2 |
| InChIKey | QJXSSAIQAMXANW-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.91 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|