C26H38O4S — CID 54314879
methyl 7-[2-oxo-4-(1-phenylsulfanyloct-2-enyl)oxolan-3-yl]heptanoate (PubChem CID 54314879) has the molecular formula C26H38O4S and a molecular weight of 446.65 g/mol. Its IUPAC name is methyl 7-[2-oxo-4-(1-phenylsulfanyloct-2-enyl)oxolan-3-yl]heptanoate.
| Compound Name | methyl 7-[2-oxo-4-(1-phenylsulfanyloct-2-enyl)oxolan-3-yl]heptanoate |
|---|---|
| PubChem CID | 54314879 |
| Molecular Formula | C26H38O4S |
| Molecular Weight | 446.65 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | methyl 7-[2-oxo-4-(1-phenylsulfanyloct-2-enyl)oxolan-3-yl]heptanoate |
| SMILES | CCCCCC=CC(Sc1ccccc1)C1COC(=O)C1CCCCCCC(=O)OC |
| InChI | InChI=1S/C26H38O4S/c1-3-4-5-6-13-18-24(31-21-15-10-9-11-16-21)23-20-30-26(28)22(23)17-12-7-8-14-19-25(27)29-2/h9-11,13,15-16,18,22-24H,3-8,12,14,17,19-20H2,1-2H3 |
| InChIKey | SNMCTCWHAHJINM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.65 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|