C27H36ClN3O4 — CID 54409307
4-amino-5-chloro-2-methoxy-N-[[4-methoxy-1-(6-oxo-6-phenylhexyl)piperidin-4-yl]methyl]benzamide (PubChem CID 54409307) has the molecular formula C27H36ClN3O4 and a molecular weight of 502.06 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[[4-methoxy-1-(6-oxo-6-phenylhexyl)piperidin-4-yl]methyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[[4-methoxy-1-(6-oxo-6-phenylhexyl)piperidin-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 54409307 |
| Molecular Formula | C27H36ClN3O4 |
| Molecular Weight | 502.06 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[[4-methoxy-1-(6-oxo-6-phenylhexyl)piperidin-4-yl]methyl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCC1(OC)CCN(CCCCCC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H36ClN3O4/c1-34-25-18-23(29)22(28)17-21(25)26(33)30-19-27(35-2)12-15-31(16-13-27)14-8-4-7-11-24(32)20-9-5-3-6-10-20/h3,5-6,9-10,17-18H,4,7-8,11-16,19,29H2,1-2H3,(H,30,33) |
| InChIKey | VSYUGZXHOGRVJT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.06 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|