C19H21NO8 — CID 54579184
tert-butyl 2-[(1R,4R,5S,6S)-6-(4-hydroxyphenyl)-5-nitro-3,7-dioxo-2-oxabicyclo[2.2.2]octan-1-yl]acetate (PubChem CID 54579184) has the molecular formula C19H21NO8 and a molecular weight of 391.38 g/mol. Its IUPAC name is tert-butyl 2-[(1R,4R,5S,6S)-6-(4-hydroxyphenyl)-5-nitro-3,7-dioxo-2-oxabicyclo[2.2.2]octan-1-yl]acetate.
| Compound Name | tert-butyl 2-[(1R,4R,5S,6S)-6-(4-hydroxyphenyl)-5-nitro-3,7-dioxo-2-oxabicyclo[2.2.2]octan-1-yl]acetate |
|---|---|
| PubChem CID | 54579184 |
| Molecular Formula | C19H21NO8 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | tert-butyl 2-[(1R,4R,5S,6S)-6-(4-hydroxyphenyl)-5-nitro-3,7-dioxo-2-oxabicyclo[2.2.2]octan-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@]12OC(=O)[C@H](CC1=O)[C@@H]([N+](=O)[O-])[C@@H]2c1ccc(O)cc1 |
| InChI | InChI=1S/C19H21NO8/c1-18(2,3)27-14(23)9-19-13(22)8-12(17(24)28-19)16(20(25)26)15(19)10-4-6-11(21)7-5-10/h4-7,12,15-16,21H,8-9H2,1-3H3/t12-,15+,16-,19+/m1/s1 |
| InChIKey | AOQCFEPVNRHGDV-XIEZEKGWSA-N |
| XLogP | 1.74 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|