C8H10O — CID 56946667
(2,2,2-trideuterio-1-deuteriooxyethyl)benzene (PubChem CID 56946667) has the molecular formula C8H10O and a molecular weight of 126.19 g/mol. Its IUPAC name is (2,2,2-trideuterio-1-deuteriooxyethyl)benzene.
| Compound Name | (2,2,2-trideuterio-1-deuteriooxyethyl)benzene |
|---|---|
| PubChem CID | 56946667 |
| Molecular Formula | C8H10O |
| Molecular Weight | 126.19 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2,2,2-trideuterio-1-deuteriooxyethyl)benzene |
| SMILES | [2H]OC(c1ccccc1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C8H10O/c1-7(9)8-5-3-2-4-6-8/h2-7,9H,1H3/i1D3,9D |
| InChIKey | WAPNOHKVXSQRPX-JLZJBEKYSA-N |
| XLogP | 1.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |