C7H5NO4S — CID 57021513
5-(1,3-dioxol-4-ylmethylidene)-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 57021513) has the molecular formula C7H5NO4S and a molecular weight of 199.19 g/mol. Its IUPAC name is 5-(1,3-dioxol-4-ylmethylidene)-2-sulfanylidene-1,3-oxazolidin-4-one.
| Compound Name | 5-(1,3-dioxol-4-ylmethylidene)-2-sulfanylidene-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 57021513 |
| Molecular Formula | C7H5NO4S |
| Molecular Weight | 199.19 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | 5-(1,3-dioxol-4-ylmethylidene)-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | O=C1NC(=S)OC1=CC1=COCO1 |
| InChI | InChI=1S/C7H5NO4S/c9-6-5(12-7(13)8-6)1-4-2-10-3-11-4/h1-2H,3H2,(H,8,9,13) |
| InChIKey | OMLTWXIQNUZJTM-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|