C24H36O3 — CID 57080245
2-(8-methyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)-5-(2-methyloctan-2-yl)phenol (PubChem CID 57080245) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is 2-(8-methyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)-5-(2-methyloctan-2-yl)phenol.
| Compound Name | 2-(8-methyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)-5-(2-methyloctan-2-yl)phenol |
|---|---|
| PubChem CID | 57080245 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 2-(8-methyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)-5-(2-methyloctan-2-yl)phenol |
| SMILES | CCCCCCC(C)(C)c1ccc(C2=C(C)CCC3(C2)OCCO3)c(O)c1 |
| InChI | InChI=1S/C24H36O3/c1-5-6-7-8-12-23(3,4)19-9-10-20(22(25)16-19)21-17-24(13-11-18(21)2)26-14-15-27-24/h9-10,16,25H,5-8,11-15,17H2,1-4H3 |
| InChIKey | KFJADHFGELSZPO-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|