C16H19N5O6 — CID 57114392
7,8-dimethyl-3-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pyrido[3,2-g]pteridine-2,4-dione (PubChem CID 57114392) has the molecular formula C16H19N5O6 and a molecular weight of 377.36 g/mol. Its IUPAC name is 7,8-dimethyl-3-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pyrido[3,2-g]pteridine-2,4-dione.
| Compound Name | 7,8-dimethyl-3-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pyrido[3,2-g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 57114392 |
| Molecular Formula | C16H19N5O6 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 7,8-dimethyl-3-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pyrido[3,2-g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)n(C[C@H](O)[C@H](O)[C@H](O)CO)c(=O)[nH]c3nc2nc1C |
| InChI | InChI=1S/C16H19N5O6/c1-6-3-8-13(17-7(6)2)19-14-11(18-8)15(26)21(16(27)20-14)4-9(23)12(25)10(24)5-22/h3,9-10,12,22-25H,4-5H2,1-2H3,(H,17,19,20,27)/t9-,10+,12-/m0/s1 |
| InChIKey | BBEGSVWMRSQFJH-UMNHJUIQSA-N |
| XLogP | -2.28 |
| TPSA | 174.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|