C15H15N3O3 — CID 57196540
5-amino-3-butylimino-8-hydroxy-1,4-dioxonaphthalene-2-carbonitrile (PubChem CID 57196540) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 5-amino-3-butylimino-8-hydroxy-1,4-dioxonaphthalene-2-carbonitrile.
| Compound Name | 5-amino-3-butylimino-8-hydroxy-1,4-dioxonaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 57196540 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 5-amino-3-butylimino-8-hydroxy-1,4-dioxonaphthalene-2-carbonitrile |
| SMILES | CCCC/N=C1/C(=O)c2c(N)ccc(O)c2C(=O)C1C#N |
| InChI | InChI=1S/C15H15N3O3/c1-2-3-6-18-13-8(7-16)14(20)12-10(19)5-4-9(17)11(12)15(13)21/h4-5,8,19H,2-3,6,17H2,1H3/b18-13+ |
| InChIKey | PKEGUGYOVSQAHC-QGOAFFKASA-N |
| XLogP | 1.73 |
| TPSA | 116.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|