C24H47N7O2 — CID 57307236
2-N-butyl-4-N,6-N-diethyl-4-N,6-N-bis(methoxymethyl)-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 57307236) has the molecular formula C24H47N7O2 and a molecular weight of 465.69 g/mol. Its IUPAC name is 2-N-butyl-4-N,6-N-diethyl-4-N,6-N-bis(methoxymethyl)-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-butyl-4-N,6-N-diethyl-4-N,6-N-bis(methoxymethyl)-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 57307236 |
| Molecular Formula | C24H47N7O2 |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 465.38 |
| IUPAC Name | 2-N-butyl-4-N,6-N-diethyl-4-N,6-N-bis(methoxymethyl)-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(c1nc(N(CC)COC)nc(N(CC)COC)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C24H47N7O2/c1-10-13-14-31(19-15-23(4,5)28-24(6,7)16-19)22-26-20(29(11-2)17-32-8)25-21(27-22)30(12-3)18-33-9/h19,28H,10-18H2,1-9H3 |
| InChIKey | PCQQUWOYWFUOSS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|