C37H50O4Si — CID 57368128
2-[(2R,6S)-2-[tri(propan-2-yl)silyloxymethyl]-6-(trityloxymethyl)oxan-4-ylidene]ethanol (PubChem CID 57368128) has the molecular formula C37H50O4Si and a molecular weight of 586.89 g/mol. Its IUPAC name is 2-[(2R,6S)-2-[tri(propan-2-yl)silyloxymethyl]-6-(trityloxymethyl)oxan-4-ylidene]ethanol.
| Compound Name | 2-[(2R,6S)-2-[tri(propan-2-yl)silyloxymethyl]-6-(trityloxymethyl)oxan-4-ylidene]ethanol |
|---|---|
| PubChem CID | 57368128 |
| Molecular Formula | C37H50O4Si |
| Molecular Weight | 586.89 g/mol |
| Exact Mass | 586.35 |
| IUPAC Name | 2-[(2R,6S)-2-[tri(propan-2-yl)silyloxymethyl]-6-(trityloxymethyl)oxan-4-ylidene]ethanol |
| SMILES | CC(C)[Si](OC[C@H]1CC(=CCO)C[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1)(C(C)C)C(C)C |
| InChI | InChI=1S/C37H50O4Si/c1-28(2)42(29(3)4,30(5)6)40-27-36-25-31(22-23-38)24-35(41-36)26-39-37(32-16-10-7-11-17-32,33-18-12-8-13-19-33)34-20-14-9-15-21-34/h7-22,28-30,35-36,38H,23-27H2,1-6H3/t35-,36+/m0/s1 |
| InChIKey | XMKFDEKPFIJQBV-MPQUPPDSSA-N |
| XLogP | 8.65 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.89 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|