C27H49N3O4 — CID 58333065
trans-(4S,10S)-10-[(E,2R)-7,7-dideuterio-1-hydroxy-2-methylhept-4-enyl]-11,17-dimethyl-4-propan-2-yl-1,5,11-triazacycloheptadecane-3,9,16-trione (PubChem CID 58333065) has the molecular formula C27H49N3O4 and a molecular weight of 481.72 g/mol. Its IUPAC name is trans-(4S,10S)-10-[(E,2R)-7,7-dideuterio-1-hydroxy-2-methylhept-4-enyl]-11,17-dimethyl-4-propan-2-yl-1,5,11-triazacycloheptadecane-3,9,16-trione.
| Compound Name | trans-(4S,10S)-10-[(E,2R)-7,7-dideuterio-1-hydroxy-2-methylhept-4-enyl]-11,17-dimethyl-4-propan-2-yl-1,5,11-triazacycloheptadecane-3,9,16-trione |
|---|---|
| PubChem CID | 58333065 |
| Molecular Formula | C27H49N3O4 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.38 |
| IUPAC Name | trans-(4S,10S)-10-[(E,2R)-7,7-dideuterio-1-hydroxy-2-methylhept-4-enyl]-11,17-dimethyl-4-propan-2-yl-1,5,11-triazacycloheptadecane-3,9,16-trione |
| SMILES | [2H]C([2H])C/C=C/C[C@@H](C)C(O)[C@H]1C(=O)CCCN[C@@H](C(C)C)C(=O)CNC(C)C(=O)CCCCN1C |
| InChI | InChI=1S/C27H49N3O4/c1-7-8-9-13-20(4)27(34)26-23(32)15-12-16-28-25(19(2)3)24(33)18-29-21(5)22(31)14-10-11-17-30(26)6/h8-9,19-21,25-29,34H,7,10-18H2,1-6H3/b9-8+/t20-,21?,25+,26-,27?/m1/s1/i1D2 |
| InChIKey | QCHPYRGJEWJEHP-NIJREKJYSA-N |
| XLogP | 2.90 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|