C23H30F2N4O5S — CID 58623203
4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide (PubChem CID 58623203) has the molecular formula C23H30F2N4O5S and a molecular weight of 512.58 g/mol. Its IUPAC name is 4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide.
| Compound Name | 4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 58623203 |
| Molecular Formula | C23H30F2N4O5S |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 4-[4-[5-(3,3-difluorobutyl)pyrazin-2-yl]phenyl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(-c3cnc(CCC(C)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C23H30F2N4O5S/c1-22(24,25)8-7-18-15-27-20(16-26-18)17-3-5-19(6-4-17)35(32,33)23(21(30)28-31)9-11-29(12-10-23)13-14-34-2/h3-6,15-16,31H,7-14H2,1-2H3,(H,28,30) |
| InChIKey | WLCYVTTXSVXCPU-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|