C22H27F3N4O5S — CID 58623231
N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(3,3,3-trifluoropropyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 58623231) has the molecular formula C22H27F3N4O5S and a molecular weight of 516.54 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(3,3,3-trifluoropropyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(3,3,3-trifluoropropyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 58623231 |
| Molecular Formula | C22H27F3N4O5S |
| Molecular Weight | 516.54 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[5-(3,3,3-trifluoropropyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)c2ccc(-c3cnc(CCC(F)(F)F)cn3)cc2)CC1 |
| InChI | InChI=1S/C22H27F3N4O5S/c1-34-13-12-29-10-8-21(9-11-29,20(30)28-31)35(32,33)18-4-2-16(3-5-18)19-15-26-17(14-27-19)6-7-22(23,24)25/h2-5,14-15,31H,6-13H2,1H3,(H,28,30) |
| InChIKey | LZBLDSGEUQPXAY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.54 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|