C14H15Yb- — CID 58669101
4,6,7,8-tetramethyl-1H-naphthalen-1-ide;ytterbium (PubChem CID 58669101) has the molecular formula C14H15Yb- and a molecular weight of 356.31 g/mol. Its IUPAC name is 4,6,7,8-tetramethyl-1H-naphthalen-1-ide;ytterbium.
| Compound Name | 4,6,7,8-tetramethyl-1H-naphthalen-1-ide;ytterbium |
|---|---|
| PubChem CID | 58669101 |
| Molecular Formula | C14H15Yb- |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 4,6,7,8-tetramethyl-1H-naphthalen-1-ide;ytterbium |
| SMILES | Cc1cc2c(C)cc[c-]c2c(C)c1C.[Yb] |
| InChI | InChI=1S/C14H15.Yb/c1-9-6-5-7-13-12(4)11(3)10(2)8-14(9)13;/h5-6,8H,1-4H3;/q-1; |
| InChIKey | SBPAKAQHIWFSMY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|