C22H21F3N2OS — CID 58791645
N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4H-indeno[1,2-d][1,3]thiazol-2-amine (PubChem CID 58791645) has the molecular formula C22H21F3N2OS and a molecular weight of 418.48 g/mol. Its IUPAC name is N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4H-indeno[1,2-d][1,3]thiazol-2-amine.
| Compound Name | N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4H-indeno[1,2-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 58791645 |
| Molecular Formula | C22H21F3N2OS |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4H-indeno[1,2-d][1,3]thiazol-2-amine |
| SMILES | CCCCCOc1ccc(Nc2nc3c(s2)Cc2ccccc2-3)cc1C(F)(F)F |
| InChI | InChI=1S/C22H21F3N2OS/c1-2-3-6-11-28-18-10-9-15(13-17(18)22(23,24)25)26-21-27-20-16-8-5-4-7-14(16)12-19(20)29-21/h4-5,7-10,13H,2-3,6,11-12H2,1H3,(H,26,27) |
| InChIKey | KGVMIUHSGQDXBB-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|