C15H16BrF3N2OS — CID 58791927
5-bromo-N-[4-pentoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 58791927) has the molecular formula C15H16BrF3N2OS and a molecular weight of 409.27 g/mol. Its IUPAC name is 5-bromo-N-[4-pentoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | 5-bromo-N-[4-pentoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791927 |
| Molecular Formula | C15H16BrF3N2OS |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 5-bromo-N-[4-pentoxy-3-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | CCCCCOc1ccc(Nc2ncc(Br)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C15H16BrF3N2OS/c1-2-3-4-7-22-12-6-5-10(8-11(12)15(17,18)19)21-14-20-9-13(16)23-14/h5-6,8-9H,2-4,7H2,1H3,(H,20,21) |
| InChIKey | RXZNUYAJUILONF-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|