C26H29F3N2O4S — CID 58791244
ethyl 2-[4-[5-methyl-2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]phenoxy]acetate (PubChem CID 58791244) has the molecular formula C26H29F3N2O4S and a molecular weight of 522.59 g/mol. Its IUPAC name is ethyl 2-[4-[5-methyl-2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-[5-methyl-2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 58791244 |
| Molecular Formula | C26H29F3N2O4S |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | ethyl 2-[4-[5-methyl-2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]phenoxy]acetate |
| SMILES | CCCCCOc1ccc(Nc2nc(-c3ccc(OCC(=O)OCC)cc3)c(C)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C26H29F3N2O4S/c1-4-6-7-14-34-22-13-10-19(15-21(22)26(27,28)29)30-25-31-24(17(3)36-25)18-8-11-20(12-9-18)35-16-23(32)33-5-2/h8-13,15H,4-7,14,16H2,1-3H3,(H,30,31) |
| InChIKey | WASIXXMRFINIDC-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|