C20H22F12O4 — CID 58820908
2-[2-[3-butan-2-yl-5-[1,1,1,3,3,3-hexafluoro-2-(2-hydroxyethoxy)propan-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyethanol (PubChem CID 58820908) has the molecular formula C20H22F12O4 and a molecular weight of 554.37 g/mol. Its IUPAC name is 2-[2-[3-butan-2-yl-5-[1,1,1,3,3,3-hexafluoro-2-(2-hydroxyethoxy)propan-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyethanol.
| Compound Name | 2-[2-[3-butan-2-yl-5-[1,1,1,3,3,3-hexafluoro-2-(2-hydroxyethoxy)propan-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyethanol |
|---|---|
| PubChem CID | 58820908 |
| Molecular Formula | C20H22F12O4 |
| Molecular Weight | 554.37 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | 2-[2-[3-butan-2-yl-5-[1,1,1,3,3,3-hexafluoro-2-(2-hydroxyethoxy)propan-2-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]oxyethanol |
| SMILES | CCC(C)c1cc(C(OCCO)(C(F)(F)F)C(F)(F)F)cc(C(OCCO)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C20H22F12O4/c1-3-11(2)12-8-13(15(17(21,22)23,18(24,25)26)35-6-4-33)10-14(9-12)16(19(27,28)29,20(30,31)32)36-7-5-34/h8-11,33-34H,3-7H2,1-2H3 |
| InChIKey | GFCIUMAJTIREOZ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.37 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |