C26H34O5 — CID 58825789
9,10-dibutoxy-1,3,8-trimethoxy-6-methylanthracene (PubChem CID 58825789) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is 9,10-dibutoxy-1,3,8-trimethoxy-6-methylanthracene.
| Compound Name | 9,10-dibutoxy-1,3,8-trimethoxy-6-methylanthracene |
|---|---|
| PubChem CID | 58825789 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 9,10-dibutoxy-1,3,8-trimethoxy-6-methylanthracene |
| SMILES | CCCCOc1c2cc(C)cc(OC)c2c(OCCCC)c2c(OC)cc(OC)cc12 |
| InChI | InChI=1S/C26H34O5/c1-7-9-11-30-25-19-13-17(3)14-21(28-5)23(19)26(31-12-10-8-2)24-20(25)15-18(27-4)16-22(24)29-6/h13-16H,7-12H2,1-6H3 |
| InChIKey | KFIMKVZQHVPCGN-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|