C16H30O3Si — CID 58906143
trans-(3R,4E,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one (PubChem CID 58906143) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is trans-(3R,4E,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one.
| Compound Name | trans-(3R,4E,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one |
|---|---|
| PubChem CID | 58906143 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | trans-(3R,4E,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4-butylidene-5-hydroxycyclohexan-1-one |
| SMILES | CCC/C=C1\[C@H](O)CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O3Si/c1-7-8-9-13-14(18)10-12(17)11-15(13)19-20(5,6)16(2,3)4/h9,14-15,18H,7-8,10-11H2,1-6H3/b13-9+/t14-,15-/m1/s1 |
| InChIKey | ONRZJOJDRZOTHY-IVBVFNMWSA-N |
| XLogP | 3.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|