C14H20N4O — CID 58997501
2-[(Z)-[3-acetyl-5-(2-methylpropyl)phenyl]methylideneamino]guanidine (PubChem CID 58997501) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-[(Z)-[3-acetyl-5-(2-methylpropyl)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[(Z)-[3-acetyl-5-(2-methylpropyl)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 58997501 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-[(Z)-[3-acetyl-5-(2-methylpropyl)phenyl]methylideneamino]guanidine |
| SMILES | CC(=O)c1cc(/C=N\N=C(N)N)cc(CC(C)C)c1 |
| InChI | InChI=1S/C14H20N4O/c1-9(2)4-11-5-12(8-17-18-14(15)16)7-13(6-11)10(3)19/h5-9H,4H2,1-3H3,(H4,15,16,18)/b17-8- |
| InChIKey | BCFXOIIAPIVVET-IUXPMGMMSA-N |
| XLogP | 1.70 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|