C21H16Y-2 — CID 59742356
carbanide;6,12-dihydro-2H-indeno[1,2-b]fluoren-2-ide;yttrium (PubChem CID 59742356) has the molecular formula C21H16Y-2 and a molecular weight of 357.27 g/mol. Its IUPAC name is carbanide;6,12-dihydro-2H-indeno[1,2-b]fluoren-2-ide;yttrium.
| Compound Name | carbanide;6,12-dihydro-2H-indeno[1,2-b]fluoren-2-ide;yttrium |
|---|---|
| PubChem CID | 59742356 |
| Molecular Formula | C21H16Y-2 |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | carbanide;6,12-dihydro-2H-indeno[1,2-b]fluoren-2-ide;yttrium |
| SMILES | [CH3-].[Y].[c-]1ccc2c(c1)Cc1cc3c(cc1-2)Cc1ccccc1-3 |
| InChI | InChI=1S/C20H13.CH3.Y/c1-3-7-17-13(5-1)9-15-11-20-16(12-19(15)17)10-14-6-2-4-8-18(14)20;;/h1,3-8,11-12H,9-10H2;1H3;/q2*-1; |
| InChIKey | NDAYAMMXOFJWEQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|