C20H34N2O6 — CID 59885055
(E)-3-(2,2-dimethylbutyl)-2-[2-(ethylamino)-2-oxoethyl]-5-(ethylcarbamoyl)hept-3-enedioic acid (PubChem CID 59885055) has the molecular formula C20H34N2O6 and a molecular weight of 398.50 g/mol. Its IUPAC name is (E)-3-(2,2-dimethylbutyl)-2-[2-(ethylamino)-2-oxoethyl]-5-(ethylcarbamoyl)hept-3-enedioic acid.
| Compound Name | (E)-3-(2,2-dimethylbutyl)-2-[2-(ethylamino)-2-oxoethyl]-5-(ethylcarbamoyl)hept-3-enedioic acid |
|---|---|
| PubChem CID | 59885055 |
| Molecular Formula | C20H34N2O6 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | (E)-3-(2,2-dimethylbutyl)-2-[2-(ethylamino)-2-oxoethyl]-5-(ethylcarbamoyl)hept-3-enedioic acid |
| SMILES | CCNC(=O)CC(C(=O)O)/C(=C/C(CC(=O)O)C(=O)NCC)CC(C)(C)CC |
| InChI | InChI=1S/C20H34N2O6/c1-6-20(4,5)12-14(15(19(27)28)11-16(23)21-7-2)9-13(10-17(24)25)18(26)22-8-3/h9,13,15H,6-8,10-12H2,1-5H3,(H,21,23)(H,22,26)(H,24,25)(H,27,28)/b14-9+ |
| InChIKey | YVRMRONONBNQPS-NTEUORMPSA-N |
| XLogP | 2.19 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|