C39H54O6 — CID 59899187
[4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenyl] 8-[(2R)-3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]octa-5,6-dienoate (PubChem CID 59899187) has the molecular formula C39H54O6 and a molecular weight of 618.86 g/mol. Its IUPAC name is [4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenyl] 8-[(2R)-3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]octa-5,6-dienoate.
| Compound Name | [4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenyl] 8-[(2R)-3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]octa-5,6-dienoate |
|---|---|
| PubChem CID | 59899187 |
| Molecular Formula | C39H54O6 |
| Molecular Weight | 618.86 g/mol |
| Exact Mass | 618.39 |
| IUPAC Name | [4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenyl] 8-[(2R)-3,5-dihydroxy-2-(3-hydroxyoctyl)cyclopentyl]octa-5,6-dienoate |
| SMILES | CCCCCC(O)CC[C@H]1C(O)CC(O)C1CC=C=CCCCC(=O)Oc1ccc(/C(CC)=C(\CC)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C39H54O6/c1-4-7-11-14-30(40)23-26-36-35(37(42)27-38(36)43)15-12-9-8-10-13-16-39(44)45-32-24-19-29(20-25-32)34(6-3)33(5-2)28-17-21-31(41)22-18-28/h8,12,17-22,24-25,30,35-38,40-43H,4-7,10-11,13-16,23,26-27H2,1-3H3/b34-33+/t9?,30?,35?,36-,37?,38?/m1/s1 |
| InChIKey | PUQAECGJYCMZAF-FDJXLRFPSA-N |
| XLogP | 8.38 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.86 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|