C22H17N3O5 — CID 6035335
(6Z)-1-acetyl-6-(1,3-benzodioxol-5-ylmethylidene)-2-benzyl-2H-imidazo[1,2-a]imidazole-3,5-dione (PubChem CID 6035335) has the molecular formula C22H17N3O5 and a molecular weight of 403.39 g/mol. Its IUPAC name is (6Z)-1-acetyl-6-(1,3-benzodioxol-5-ylmethylidene)-2-benzyl-2H-imidazo[1,2-a]imidazole-3,5-dione.
| Compound Name | (6Z)-1-acetyl-6-(1,3-benzodioxol-5-ylmethylidene)-2-benzyl-2H-imidazo[1,2-a]imidazole-3,5-dione |
|---|---|
| PubChem CID | 6035335 |
| Molecular Formula | C22H17N3O5 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (6Z)-1-acetyl-6-(1,3-benzodioxol-5-ylmethylidene)-2-benzyl-2H-imidazo[1,2-a]imidazole-3,5-dione |
| SMILES | CC(=O)N1C2=N/C(=C\c3ccc4c(c3)OCO4)C(=O)N2C(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C22H17N3O5/c1-13(26)24-17(10-14-5-3-2-4-6-14)21(28)25-20(27)16(23-22(24)25)9-15-7-8-18-19(11-15)30-12-29-18/h2-9,11,17H,10,12H2,1H3/b16-9- |
| InChIKey | JLTURDPMQZKXAR-SXGWCWSVSA-N |
| XLogP | 1.95 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|