C13H15ClN2O4 — CID 603683
1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione (PubChem CID 603683) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 603683 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1cc(OC)c(NCN2C(=O)CCC2=O)cc1Cl |
| InChI | InChI=1S/C13H15ClN2O4/c1-19-10-6-11(20-2)9(5-8(10)14)15-7-16-12(17)3-4-13(16)18/h5-6,15H,3-4,7H2,1-2H3 |
| InChIKey | OMEOGUVONOYTMW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|