About 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione
1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione (PubChem CID 603683) has the molecular formula C13H15ClN2O4
and a molecular weight of 298.73 g/mol. Its IUPAC name is 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione |
| PubChem CID | 603683 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1cc(OC)c(NCN2C(=O)CCC2=O)cc1Cl |
| InChI | InChI=1S/C13H15ClN2O4/c1-19-10-6-11(20-2)9(5-8(10)14)15-7-16-12(17)3-4-13(16)18/h5-6,15H,3-4,7H2,1-2H3 |
| InChIKey | OMEOGUVONOYTMW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione?
The IUPAC name of 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione (CID 603683) is 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione.
What is the SMILES notation for 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione?
The canonical SMILES for 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione is COc1cc(OC)c(NCN2C(=O)CCC2=O)cc1Cl.
What is the InChIKey of 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione?
The InChIKey is OMEOGUVONOYTMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2O4/c1-19-10-6-11(20-2)9(5-8(10)14)15-7-16-12(17)3-4-13(16)18/h5-6,15H,3-4,7H2,1-2H3.
What are the key properties of 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione?
1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione has a molecular weight of 298.73 g/mol, XLogP of 1.88, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-chloro-2,4-dimethoxyanilino)methyl]pyrrolidine-2,5-dione is sourced from PubChem (CID 603683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).