C20H17N5O5 — CID 62705533
(2R)-2-[(2R,4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]butan-2-yl]-2H-chromene-6-carbonitrile (PubChem CID 62705533) has the molecular formula C20H17N5O5 and a molecular weight of 407.39 g/mol. Its IUPAC name is (2R)-2-[(2R,4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]butan-2-yl]-2H-chromene-6-carbonitrile.
| Compound Name | (2R)-2-[(2R,4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]butan-2-yl]-2H-chromene-6-carbonitrile |
|---|---|
| PubChem CID | 62705533 |
| Molecular Formula | C20H17N5O5 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | (2R)-2-[(2R,4E)-4-[(2,4-dinitrophenyl)hydrazinylidene]butan-2-yl]-2H-chromene-6-carbonitrile |
| SMILES | C[C@H](C/C=N/Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])[C@@H]1C=Cc2cc(C#N)ccc2O1 |
| InChI | InChI=1S/C20H17N5O5/c1-13(19-7-3-15-10-14(12-21)2-6-20(15)30-19)8-9-22-23-17-5-4-16(24(26)27)11-18(17)25(28)29/h2-7,9-11,13,19,23H,8H2,1H3/b22-9+/t13-,19+/m1/s1 |
| InChIKey | LYUUJVYDSTUJQL-WNLUSHBDSA-N |
| XLogP | 4.27 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|