C15H21N5O4Si — CID 71326273
4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-5-trimethylsilylpentanenitrile (PubChem CID 71326273) has the molecular formula C15H21N5O4Si and a molecular weight of 363.45 g/mol. Its IUPAC name is 4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-5-trimethylsilylpentanenitrile.
| Compound Name | 4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-5-trimethylsilylpentanenitrile |
|---|---|
| PubChem CID | 71326273 |
| Molecular Formula | C15H21N5O4Si |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-5-trimethylsilylpentanenitrile |
| SMILES | C[Si](C)(C)CC(C=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])CCC#N |
| InChI | InChI=1S/C15H21N5O4Si/c1-25(2,3)11-12(5-4-8-16)10-17-18-14-7-6-13(19(21)22)9-15(14)20(23)24/h6-7,9-10,12,18H,4-5,11H2,1-3H3 |
| InChIKey | ASLGVRIHQICLBZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 134.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|