C16H15N7O4 — CID 3802292
N-[3-(benzotriazol-1-yl)butylideneamino]-2,4-dinitroaniline (PubChem CID 3802292) has the molecular formula C16H15N7O4 and a molecular weight of 369.34 g/mol. Its IUPAC name is N-[3-(benzotriazol-1-yl)butylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[3-(benzotriazol-1-yl)butylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 3802292 |
| Molecular Formula | C16H15N7O4 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | N-[3-(benzotriazol-1-yl)butylideneamino]-2,4-dinitroaniline |
| SMILES | CC(CC=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])n1nnc2ccccc21 |
| InChI | InChI=1S/C16H15N7O4/c1-11(21-15-5-3-2-4-13(15)19-20-21)8-9-17-18-14-7-6-12(22(24)25)10-16(14)23(26)27/h2-7,9-11,18H,8H2,1H3 |
| InChIKey | UKJFMUHGYNYXNW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 141.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|