C25H30N4O9 — CID 6444212
bis((Z)-but-2-enedioic acid);1-[3-(dimethylamino)propylamino]-4-methyl-5H-pyrido[4,3-b]indol-8-ol (PubChem CID 6444212) has the molecular formula C25H30N4O9 and a molecular weight of 530.53 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);1-[3-(dimethylamino)propylamino]-4-methyl-5H-pyrido[4,3-b]indol-8-ol.
| Compound Name | bis((Z)-but-2-enedioic acid);1-[3-(dimethylamino)propylamino]-4-methyl-5H-pyrido[4,3-b]indol-8-ol |
|---|---|
| PubChem CID | 6444212 |
| Molecular Formula | C25H30N4O9 |
| Molecular Weight | 530.53 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);1-[3-(dimethylamino)propylamino]-4-methyl-5H-pyrido[4,3-b]indol-8-ol |
| SMILES | Cc1cnc(NCCCN(C)C)c2c1[nH]c1ccc(O)cc12.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H22N4O.2C4H4O4/c1-11-10-19-17(18-7-4-8-21(2)3)15-13-9-12(22)5-6-14(13)20-16(11)15;2*5-3(6)1-2-4(7)8/h5-6,9-10,20,22H,4,7-8H2,1-3H3,(H,18,19);2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | IXWODIBBQAQKKK-SPIKMXEPSA-N |
| XLogP | 2.52 |
| TPSA | 213.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.53 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|