C17H11N5O8 — CID 6479612
2-[(2,4-dinitroanilino)carbamoyl]-8-hydroxyquinoline-7-carboxylic acid (PubChem CID 6479612) has the molecular formula C17H11N5O8 and a molecular weight of 413.30 g/mol. Its IUPAC name is 2-[(2,4-dinitroanilino)carbamoyl]-8-hydroxyquinoline-7-carboxylic acid.
| Compound Name | 2-[(2,4-dinitroanilino)carbamoyl]-8-hydroxyquinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 6479612 |
| Molecular Formula | C17H11N5O8 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 2-[(2,4-dinitroanilino)carbamoyl]-8-hydroxyquinoline-7-carboxylic acid |
| SMILES | O=C(NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccc2ccc(C(=O)O)c(O)c2n1 |
| InChI | InChI=1S/C17H11N5O8/c23-15-10(17(25)26)4-1-8-2-5-12(18-14(8)15)16(24)20-19-11-6-3-9(21(27)28)7-13(11)22(29)30/h1-7,19,23H,(H,20,24)(H,25,26) |
| InChIKey | PKZCZJOXJSYLGZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 197.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|