C16H20ClN — CID 65335078
3-tert-butyl-8-chloro-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 65335078) has the molecular formula C16H20ClN and a molecular weight of 261.80 g/mol. Its IUPAC name is 3-tert-butyl-8-chloro-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 3-tert-butyl-8-chloro-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 65335078 |
| Molecular Formula | C16H20ClN |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-tert-butyl-8-chloro-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | CC(C)(C)C1CCc2[nH]c3c(Cl)cccc3c2C1 |
| InChI | InChI=1S/C16H20ClN/c1-16(2,3)10-7-8-14-12(9-10)11-5-4-6-13(17)15(11)18-14/h4-6,10,18H,7-9H2,1-3H3 |
| InChIKey | AYWQLDAORXREIJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|