C12H19F3O2SSi — CID 66642495
[3-[tert-butyl(dimethyl)silyl]oxy-5-(trifluoromethyl)thiophen-2-yl]methanol (PubChem CID 66642495) has the molecular formula C12H19F3O2SSi and a molecular weight of 312.43 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxy-5-(trifluoromethyl)thiophen-2-yl]methanol.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxy-5-(trifluoromethyl)thiophen-2-yl]methanol |
|---|---|
| PubChem CID | 66642495 |
| Molecular Formula | C12H19F3O2SSi |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxy-5-(trifluoromethyl)thiophen-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cc(C(F)(F)F)sc1CO |
| InChI | InChI=1S/C12H19F3O2SSi/c1-11(2,3)19(4,5)17-8-6-10(12(13,14)15)18-9(8)7-16/h6,16H,7H2,1-5H3 |
| InChIKey | PHNMXRKPVBQLAA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|